C37H37NO6S — CID 134908225
(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(1,3-thiazol-2-yl)oxan-2-ol (PubChem CID 134908225) has the molecular formula C37H37NO6S and a molecular weight of 623.77 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(1,3-thiazol-2-yl)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(1,3-thiazol-2-yl)oxan-2-ol |
|---|---|
| PubChem CID | 134908225 |
| Molecular Formula | C37H37NO6S |
| Molecular Weight | 623.77 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-(1,3-thiazol-2-yl)oxan-2-ol |
| SMILES | OC1(c2nccs2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H37NO6S/c39-37(36-38-21-22-45-36)35(43-26-31-19-11-4-12-20-31)34(42-25-30-17-9-3-10-18-30)33(41-24-29-15-7-2-8-16-29)32(44-37)27-40-23-28-13-5-1-6-14-28/h1-22,32-35,39H,23-27H2/t32-,33-,34+,35-,37?/m1/s1 |
| InChIKey | GUQAWDZPBOBRNR-MVQSBWCGSA-N |
| XLogP | 6.66 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.77 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |