C37H37NO5S — CID 10031614
2-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,3-thiazole (PubChem CID 10031614) has the molecular formula C37H37NO5S and a molecular weight of 607.77 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,3-thiazole.
| Compound Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 10031614 |
| Molecular Formula | C37H37NO5S |
| Molecular Weight | 607.77 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,3-thiazole |
| SMILES | c1ccc(COC[C@H]2O[C@@H](c3nccs3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H37NO5S/c1-5-13-28(14-6-1)23-39-27-32-33(40-24-29-15-7-2-8-16-29)34(41-25-30-17-9-3-10-18-30)35(36(43-32)37-38-21-22-44-37)42-26-31-19-11-4-12-20-31/h1-22,32-36H,23-27H2/t32-,33+,34+,35-,36-/m1/s1 |
| InChIKey | QBHWFPXQVMFWJI-FGZSBDNFSA-N |
| XLogP | 7.56 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.77 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |