C47H46O5S — CID 59279091
(3S,3'R,4'S,5'S,6'R)-5-ethyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-benzo[e][2]benzofuran-3,2'-thiane] (PubChem CID 59279091) has the molecular formula C47H46O5S and a molecular weight of 722.95 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-5-ethyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-benzo[e][2]benzofuran-3,2'-thiane].
| Compound Name | (3S,3'R,4'S,5'S,6'R)-5-ethyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-benzo[e][2]benzofuran-3,2'-thiane] |
|---|---|
| PubChem CID | 59279091 |
| Molecular Formula | C47H46O5S |
| Molecular Weight | 722.95 g/mol |
| Exact Mass | 722.31 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-5-ethyl-3',4',5'-tris(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[1H-benzo[e][2]benzofuran-3,2'-thiane] |
| SMILES | CCc1cc2c(c3ccccc13)CO[C@]21S[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C47H46O5S/c1-2-38-27-42-41(40-26-16-15-25-39(38)40)32-52-47(42)46(51-31-37-23-13-6-14-24-37)45(50-30-36-21-11-5-12-22-36)44(49-29-35-19-9-4-10-20-35)43(53-47)33-48-28-34-17-7-3-8-18-34/h3-27,43-46H,2,28-33H2,1H3/t43-,44-,45+,46-,47+/m1/s1 |
| InChIKey | AJZDJWVHFUPEEI-LKAPIVENSA-N |
| XLogP | 10.17 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.95 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |