C50H52O7S — CID 46202242
(3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol (PubChem CID 46202242) has the molecular formula C50H52O7S and a molecular weight of 797.03 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol.
| Compound Name | (3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
|---|---|
| PubChem CID | 46202242 |
| Molecular Formula | C50H52O7S |
| Molecular Weight | 797.03 g/mol |
| Exact Mass | 796.34 |
| IUPAC Name | (3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
| SMILES | CCOc1ccc(Cc2ccc(OC)c(C3(O)S[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C50H52O7S/c1-3-54-43-27-24-37(25-28-43)30-42-26-29-45(52-2)44(31-42)50(51)49(57-35-41-22-14-7-15-23-41)48(56-34-40-20-12-6-13-21-40)47(55-33-39-18-10-5-11-19-39)46(58-50)36-53-32-38-16-8-4-9-17-38/h4-29,31,46-49,51H,3,30,32-36H2,1-2H3/t46-,47-,48+,49-,50?/m1/s1 |
| InChIKey | RKQXNWICNZBSNH-ULJHBXBISA-N |
| XLogP | 9.92 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.03 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |