C50H51ClO5S — CID 46202899
(3R,4S,5S,6R)-2-[4-chloro-3-[(4-propan-2-ylphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol (PubChem CID 46202899) has the molecular formula C50H51ClO5S and a molecular weight of 799.47 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[4-chloro-3-[(4-propan-2-ylphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol.
| Compound Name | (3R,4S,5S,6R)-2-[4-chloro-3-[(4-propan-2-ylphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
|---|---|
| PubChem CID | 46202899 |
| Molecular Formula | C50H51ClO5S |
| Molecular Weight | 799.47 g/mol |
| Exact Mass | 798.31 |
| IUPAC Name | (3R,4S,5S,6R)-2-[4-chloro-3-[(4-propan-2-ylphenyl)methyl]phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
| SMILES | CC(C)c1ccc(Cc2cc(C3(O)S[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C50H51ClO5S/c1-36(2)42-25-23-37(24-26-42)29-43-30-44(27-28-45(43)51)50(52)49(56-34-41-21-13-6-14-22-41)48(55-33-40-19-11-5-12-20-40)47(54-32-39-17-9-4-10-18-39)46(57-50)35-53-31-38-15-7-3-8-16-38/h3-28,30,36,46-49,52H,29,31-35H2,1-2H3/t46-,47-,48+,49-,50?/m1/s1 |
| InChIKey | QDYGCLXGAJPSQB-ULJHBXBISA-N |
| XLogP | 11.29 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.47 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |