C51H51ClO4 — CID 91441898
1-chloro-2-[(4-ethylphenyl)methyl]-4-[(1S,3R,6S)-2-methylidene-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]benzene (PubChem CID 91441898) has the molecular formula C51H51ClO4 and a molecular weight of 763.42 g/mol. Its IUPAC name is 1-chloro-2-[(4-ethylphenyl)methyl]-4-[(1S,3R,6S)-2-methylidene-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]benzene.
| Compound Name | 1-chloro-2-[(4-ethylphenyl)methyl]-4-[(1S,3R,6S)-2-methylidene-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 91441898 |
| Molecular Formula | C51H51ClO4 |
| Molecular Weight | 763.42 g/mol |
| Exact Mass | 762.35 |
| IUPAC Name | 1-chloro-2-[(4-ethylphenyl)methyl]-4-[(1S,3R,6S)-2-methylidene-4,5,6-tris(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]benzene |
| SMILES | C=C1[C@H](COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1c1ccc(Cl)c(Cc2ccc(CC)cc2)c1 |
| InChI | InChI=1S/C51H51ClO4/c1-3-38-24-26-39(27-25-38)30-45-31-44(28-29-47(45)52)48-37(2)46(36-53-32-40-16-8-4-9-17-40)49(54-33-41-18-10-5-11-19-41)51(56-35-43-22-14-7-15-23-43)50(48)55-34-42-20-12-6-13-21-42/h4-29,31,46,48-51H,2-3,30,32-36H2,1H3/t46-,48-,49?,50-,51?/m0/s1 |
| InChIKey | MNLPWDJJHCEEII-WCJVMGSRSA-N |
| XLogP | 11.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.42 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|