C49H48ClNO5S — CID 59738420
2-chloro-N-(4-ethylphenyl)-5-[(2S,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]benzamide (PubChem CID 59738420) has the molecular formula C49H48ClNO5S and a molecular weight of 798.45 g/mol. Its IUPAC name is 2-chloro-N-(4-ethylphenyl)-5-[(2S,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]benzamide.
| Compound Name | 2-chloro-N-(4-ethylphenyl)-5-[(2S,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]benzamide |
|---|---|
| PubChem CID | 59738420 |
| Molecular Formula | C49H48ClNO5S |
| Molecular Weight | 798.45 g/mol |
| Exact Mass | 797.29 |
| IUPAC Name | 2-chloro-N-(4-ethylphenyl)-5-[(2S,3R,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-yl]benzamide |
| SMILES | CCc1ccc(NC(=O)c2cc([C@@H]3S[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C49H48ClNO5S/c1-2-35-23-26-41(27-24-35)51-49(52)42-29-40(25-28-43(42)50)48-47(56-33-39-21-13-6-14-22-39)46(55-32-38-19-11-5-12-20-38)45(54-31-37-17-9-4-10-18-37)44(57-48)34-53-30-36-15-7-3-8-16-36/h3-29,44-48H,2,30-34H2,1H3,(H,51,52)/t44-,45-,46+,47?,48+/m1/s1 |
| InChIKey | LYRGMYWUMZGWKL-DJXLEMJXSA-N |
| XLogP | 11.28 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.45 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |