C21H23FO4S — CID 171035865
[3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-2-yl] acetate (PubChem CID 171035865) has the molecular formula C21H23FO4S and a molecular weight of 390.48 g/mol. Its IUPAC name is [3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-2-yl] acetate.
| Compound Name | [3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-2-yl] acetate |
|---|---|
| PubChem CID | 171035865 |
| Molecular Formula | C21H23FO4S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-2-yl] acetate |
| SMILES | CC(=O)OC1SC(COCc2ccccc2)C(OCc2ccccc2)C1F |
| InChI | InChI=1S/C21H23FO4S/c1-15(23)26-21-19(22)20(25-13-17-10-6-3-7-11-17)18(27-21)14-24-12-16-8-4-2-5-9-16/h2-11,18-21H,12-14H2,1H3 |
| InChIKey | WHXKLWJMUKJAFN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |