C14H17FO3S — CID 135013187
[(5S)-3-fluoro-5-(phenylmethoxymethyl)thiolan-2-yl] acetate (PubChem CID 135013187) has the molecular formula C14H17FO3S and a molecular weight of 284.35 g/mol. Its IUPAC name is [(5S)-3-fluoro-5-(phenylmethoxymethyl)thiolan-2-yl] acetate.
| Compound Name | [(5S)-3-fluoro-5-(phenylmethoxymethyl)thiolan-2-yl] acetate |
|---|---|
| PubChem CID | 135013187 |
| Molecular Formula | C14H17FO3S |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [(5S)-3-fluoro-5-(phenylmethoxymethyl)thiolan-2-yl] acetate |
| SMILES | CC(=O)OC1S[C@H](COCc2ccccc2)CC1F |
| InChI | InChI=1S/C14H17FO3S/c1-10(16)18-14-13(15)7-12(19-14)9-17-8-11-5-3-2-4-6-11/h2-6,12-14H,7-9H2,1H3/t12-,13?,14?/m0/s1 |
| InChIKey | UEZHQNJBSNZHMT-HSBZDZAISA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |