C44H76F2N2O10 — CID 118401555
ethyl (2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 118401555) has the molecular formula C44H76F2N2O10 and a molecular weight of 831.09 g/mol. Its IUPAC name is ethyl (2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | ethyl (2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 118401555 |
| Molecular Formula | C44H76F2N2O10 |
| Molecular Weight | 831.09 g/mol |
| Exact Mass | 830.55 |
| IUPAC Name | ethyl (2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCCCOC[C@H]1O[C@@](OCCCC)(C(F)(F)CNCCCC[C@H](NC(=O)OCc2ccccc2)C(=O)OCC)[C@H](OCCCC)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C44H76F2N2O10/c1-7-13-27-51-33-37-38(53-28-14-8-2)39(54-29-15-9-3)40(55-30-16-10-4)44(58-37,57-31-17-11-5)43(45,46)34-47-26-22-21-25-36(41(49)52-12-6)48-42(50)56-32-35-23-19-18-20-24-35/h18-20,23-24,36-40,47H,7-17,21-22,25-34H2,1-6H3,(H,48,50)/t36-,37+,38-,39-,40+,44+/m0/s1 |
| InChIKey | NDLMDQUSCKMSHL-IWEJKAGVSA-N |
| XLogP | 8.52 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.09 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|