C42H80F2N2O9 — CID 126481358
butyl (2S)-2-[[(2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-methylhexanoyl]amino]propanoate (PubChem CID 126481358) has the molecular formula C42H80F2N2O9 and a molecular weight of 795.10 g/mol. Its IUPAC name is butyl (2S)-2-[[(2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-methylhexanoyl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[(2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-methylhexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 126481358 |
| Molecular Formula | C42H80F2N2O9 |
| Molecular Weight | 795.10 g/mol |
| Exact Mass | 794.58 |
| IUPAC Name | butyl (2S)-2-[[(2S)-6-[[2,2-difluoro-2-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrabutoxy-6-(butoxymethyl)oxan-2-yl]ethyl]amino]-2-methylhexanoyl]amino]propanoate |
| SMILES | CCCCOC[C@H]1O[C@@](OCCCC)(C(F)(F)CNCCCC[C@H](C)C(=O)N[C@@H](C)C(=O)OCCCC)[C@H](OCCCC)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C42H80F2N2O9/c1-9-15-25-49-31-35-36(50-26-16-10-2)37(51-27-17-11-3)38(52-28-18-12-4)42(55-35,54-30-20-14-6)41(43,44)32-45-24-22-21-23-33(7)39(47)46-34(8)40(48)53-29-19-13-5/h33-38,45H,9-32H2,1-8H3,(H,46,47)/t33-,34-,35+,36-,37-,38+,42+/m0/s1 |
| InChIKey | GWYPAFUJGBNVBL-QEACXCARSA-N |
| XLogP | 8.15 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.10 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|