C24H40N2O6 — CID 118616211
butyl (2S)-6-[bis(2-hydroxypropyl)amino]-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 118616211) has the molecular formula C24H40N2O6 and a molecular weight of 452.59 g/mol. Its IUPAC name is butyl (2S)-6-[bis(2-hydroxypropyl)amino]-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | butyl (2S)-6-[bis(2-hydroxypropyl)amino]-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 118616211 |
| Molecular Formula | C24H40N2O6 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | butyl (2S)-6-[bis(2-hydroxypropyl)amino]-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCCCOC(=O)[C@H](CCCCN(CC(C)O)CC(C)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H40N2O6/c1-4-5-15-31-23(29)22(25-24(30)32-18-21-11-7-6-8-12-21)13-9-10-14-26(16-19(2)27)17-20(3)28/h6-8,11-12,19-20,22,27-28H,4-5,9-10,13-18H2,1-3H3,(H,25,30)/t19?,20?,22-/m0/s1 |
| InChIKey | HUAGUEAMMWKZPV-AOMIVXANSA-N |
| XLogP | 2.86 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|