C19H38O5 — CID 118528134
(3S,4S,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)-3-methyloxan-3-ol (PubChem CID 118528134) has the molecular formula C19H38O5 and a molecular weight of 346.51 g/mol. Its IUPAC name is (3S,4S,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)-3-methyloxan-3-ol.
| Compound Name | (3S,4S,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)-3-methyloxan-3-ol |
|---|---|
| PubChem CID | 118528134 |
| Molecular Formula | C19H38O5 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | (3S,4S,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)-3-methyloxan-3-ol |
| SMILES | CCCCOC[C@H]1OC[C@](C)(O)[C@@H](OCCCC)C1OCCCC |
| InChI | InChI=1S/C19H38O5/c1-5-8-11-21-14-16-17(22-12-9-6-2)18(23-13-10-7-3)19(4,20)15-24-16/h16-18,20H,5-15H2,1-4H3/t16-,17?,18+,19+/m1/s1 |
| InChIKey | KKOLAFKEWUXVCJ-DXPBQALJSA-N |
| XLogP | 3.32 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|