C11H22O4 — CID 70948147
[(4S,5S)-5-(butoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol (PubChem CID 70948147) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is [(4S,5S)-5-(butoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4S,5S)-5-(butoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 70948147 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | [(4S,5S)-5-(butoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| SMILES | CCCCOC[C@@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C11H22O4/c1-4-5-6-13-8-10-9(7-12)14-11(2,3)15-10/h9-10,12H,4-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | YYWFMDGHTOLZBA-UWVGGRQHSA-N |
| XLogP | 1.32 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|