C14H26F2O4 — CID 90339210
(2R,3R,5R)-4-butoxy-5-(butoxymethyl)-3-fluoro-3-(fluoromethyl)oxolan-2-ol (PubChem CID 90339210) has the molecular formula C14H26F2O4 and a molecular weight of 296.35 g/mol. Its IUPAC name is (2R,3R,5R)-4-butoxy-5-(butoxymethyl)-3-fluoro-3-(fluoromethyl)oxolan-2-ol.
| Compound Name | (2R,3R,5R)-4-butoxy-5-(butoxymethyl)-3-fluoro-3-(fluoromethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 90339210 |
| Molecular Formula | C14H26F2O4 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2R,3R,5R)-4-butoxy-5-(butoxymethyl)-3-fluoro-3-(fluoromethyl)oxolan-2-ol |
| SMILES | CCCCOC[C@H]1O[C@@H](O)[C@@](F)(CF)C1OCCCC |
| InChI | InChI=1S/C14H26F2O4/c1-3-5-7-18-9-11-12(19-8-6-4-2)14(16,10-15)13(17)20-11/h11-13,17H,3-10H2,1-2H3/t11-,12?,13-,14-/m1/s1 |
| InChIKey | RGYZSEAXNLXFOF-ZXCYLUJYSA-N |
| XLogP | 2.38 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|