C13H26O3 — CID 167593044
(3S,5S,6R)-2-(butoxymethyl)-4,5,6-trimethyloxan-3-ol (PubChem CID 167593044) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is (3S,5S,6R)-2-(butoxymethyl)-4,5,6-trimethyloxan-3-ol.
| Compound Name | (3S,5S,6R)-2-(butoxymethyl)-4,5,6-trimethyloxan-3-ol |
|---|---|
| PubChem CID | 167593044 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | (3S,5S,6R)-2-(butoxymethyl)-4,5,6-trimethyloxan-3-ol |
| SMILES | CCCCOCC1O[C@H](C)[C@@H](C)C(C)[C@@H]1O |
| InChI | InChI=1S/C13H26O3/c1-5-6-7-15-8-12-13(14)10(3)9(2)11(4)16-12/h9-14H,5-8H2,1-4H3/t9-,10?,11+,12?,13-/m0/s1 |
| InChIKey | ULSJFDVKZJIYFU-PTEKRPQWSA-N |
| XLogP | 2.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|