C23H39FN2O5 — CID 118016696
1-[(2R,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-(fluoromethyl)oxolan-2-yl]-4-methylpyrimidin-2-one (PubChem CID 118016696) has the molecular formula C23H39FN2O5 and a molecular weight of 442.57 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-(fluoromethyl)oxolan-2-yl]-4-methylpyrimidin-2-one.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-(fluoromethyl)oxolan-2-yl]-4-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 118016696 |
| Molecular Formula | C23H39FN2O5 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-(fluoromethyl)oxolan-2-yl]-4-methylpyrimidin-2-one |
| SMILES | CCCCOC[C@H]1O[C@@H](n2ccc(C)nc2=O)[C@](CF)(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C23H39FN2O5/c1-5-8-13-28-16-19-20(29-14-9-6-2)23(17-24,30-15-10-7-3)21(31-19)26-12-11-18(4)25-22(26)27/h11-12,19-21H,5-10,13-17H2,1-4H3/t19-,20-,21-,23-/m1/s1 |
| InChIKey | YJUQOWWPFCJILX-YYTDSSBASA-N |
| XLogP | 3.98 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|