C25H42N4O5S — CID 70964687
(2S,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyl-2-(4-methyl-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-ol (PubChem CID 70964687) has the molecular formula C25H42N4O5S and a molecular weight of 510.70 g/mol. Its IUPAC name is (2S,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyl-2-(4-methyl-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-ol.
| Compound Name | (2S,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyl-2-(4-methyl-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-ol |
|---|---|
| PubChem CID | 70964687 |
| Molecular Formula | C25H42N4O5S |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | (2S,3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyl-2-(4-methyl-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)oxolan-2-ol |
| SMILES | CCCCOC[C@H]1O[C@@](O)(c2cnc3c(C)nc(SC)nn23)[C@](C)(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C25H42N4O5S/c1-7-10-13-31-17-19-21(32-14-11-8-2)24(5,33-15-12-9-3)25(30,34-19)20-16-26-22-18(4)27-23(35-6)28-29(20)22/h16,19,21,30H,7-15,17H2,1-6H3/t19-,21-,24-,25+/m1/s1 |
| InChIKey | TUMLRYXPPGSEIR-PPZUDANNSA-N |
| XLogP | 4.28 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|