C25H26FN5O3S — CID 166718465
7-[(3S,4R,5R)-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 166718465) has the molecular formula C25H26FN5O3S and a molecular weight of 495.58 g/mol. Its IUPAC name is 7-[(3S,4R,5R)-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(3S,4R,5R)-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 166718465 |
| Molecular Formula | C25H26FN5O3S |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 7-[(3S,4R,5R)-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CSc1nc(N)c2ncc([C@]3(F)CO[C@H](COCc4ccccc4)[C@H]3OCc3ccccc3)n2n1 |
| InChI | InChI=1S/C25H26FN5O3S/c1-35-24-29-22(27)23-28-12-20(31(23)30-24)25(26)16-34-19(15-32-13-17-8-4-2-5-9-17)21(25)33-14-18-10-6-3-7-11-18/h2-12,19,21H,13-16H2,1H3,(H2,27,29,30)/t19-,21-,25-/m1/s1 |
| InChIKey | LUKQMPRVEAFVKT-DZRGJMJISA-N |
| XLogP | 3.79 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |