C25H26FN5O3S — CID 71745547
7-[(2S,3S,4R,5R)-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 71745547) has the molecular formula C25H26FN5O3S and a molecular weight of 495.58 g/mol. Its IUPAC name is 7-[(2S,3S,4R,5R)-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(2S,3S,4R,5R)-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 71745547 |
| Molecular Formula | C25H26FN5O3S |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 7-[(2S,3S,4R,5R)-3-fluoro-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CSc1nc(N)c2ncc([C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H]3F)n2n1 |
| InChI | InChI=1S/C25H26FN5O3S/c1-35-25-29-23(27)24-28-12-18(31(24)30-25)21-20(26)22(33-14-17-10-6-3-7-11-17)19(34-21)15-32-13-16-8-4-2-5-9-16/h2-12,19-22H,13-15H2,1H3,(H2,27,29,30)/t19-,20+,21+,22-/m1/s1 |
| InChIKey | GLWGHKREXYMLGV-CLAROIROSA-N |
| XLogP | 4.01 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |