C32H34N6O4 — CID 58013237
7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]imidazo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 58013237) has the molecular formula C32H34N6O4 and a molecular weight of 566.66 g/mol. Its IUPAC name is 7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]imidazo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]imidazo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 58013237 |
| Molecular Formula | C32H34N6O4 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]imidazo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | C[C@@]1(OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H]1c1cnc2c(N)nc(N)nn12 |
| InChI | InChI=1S/C32H34N6O4/c1-32(41-20-24-15-9-4-10-16-24)27(25-17-35-30-29(33)36-31(34)37-38(25)30)42-26(21-39-18-22-11-5-2-6-12-22)28(32)40-19-23-13-7-3-8-14-23/h2-17,26-28H,18-21H2,1H3,(H4,33,34,36,37)/t26-,27+,28-,32+/m1/s1 |
| InChIKey | LUCJPJXALITLJG-IDSQFFPFSA-N |
| XLogP | 4.51 |
| TPSA | 132.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|