C33H35N5O4S — CID 58013249
7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58013249) has the molecular formula C33H35N5O4S and a molecular weight of 597.74 g/mol. Its IUPAC name is 7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58013249 |
| Molecular Formula | C33H35N5O4S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | 7-[(2S,3S,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-methylsulfanylimidazo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CSc1nc(N)c2ncc([C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@@]3(C)OCc3ccccc3)n2n1 |
| InChI | InChI=1S/C33H35N5O4S/c1-33(41-21-25-16-10-5-11-17-25)28(26-18-35-31-30(34)36-32(43-2)37-38(26)31)42-27(22-39-19-23-12-6-3-7-13-23)29(33)40-20-24-14-8-4-9-15-24/h3-18,27-29H,19-22H2,1-2H3,(H2,34,36,37)/t27-,28+,29-,33+/m1/s1 |
| InChIKey | AJLLDVBLRZDZFY-HKFRAXQBSA-N |
| XLogP | 5.65 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |