C33H32ClN3O4S — CID 59440389
4-chloro-7-[(2R,3R,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]thieno[3,4-d]pyrimidin-2-amine (PubChem CID 59440389) has the molecular formula C33H32ClN3O4S and a molecular weight of 602.16 g/mol. Its IUPAC name is 4-chloro-7-[(2R,3R,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]thieno[3,4-d]pyrimidin-2-amine.
| Compound Name | 4-chloro-7-[(2R,3R,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]thieno[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 59440389 |
| Molecular Formula | C33H32ClN3O4S |
| Molecular Weight | 602.16 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | 4-chloro-7-[(2R,3R,4R,5R)-3-methyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]thieno[3,4-d]pyrimidin-2-amine |
| SMILES | C[C@@]1(OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H]1c1scc2c(Cl)nc(N)nc12 |
| InChI | InChI=1S/C33H32ClN3O4S/c1-33(40-19-24-15-9-4-10-16-24)29(39-18-23-13-7-3-8-14-23)26(20-38-17-22-11-5-2-6-12-22)41-30(33)28-27-25(21-42-28)31(34)37-32(35)36-27/h2-16,21,26,29-30H,17-20H2,1H3,(H2,35,36)/t26-,29-,30+,33-/m1/s1 |
| InChIKey | SXKJVINLEBJGCB-LBQRHCPBSA-N |
| XLogP | 7.14 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.16 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |