C32H31ClN4O4 — CID 86586075
7-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-4-chloropyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 86586075) has the molecular formula C32H31ClN4O4 and a molecular weight of 571.08 g/mol. Its IUPAC name is 7-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-4-chloropyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-4-chloropyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 86586075 |
| Molecular Formula | C32H31ClN4O4 |
| Molecular Weight | 571.08 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 7-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-4-chloropyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Nc1nc(Cl)c2ccn([C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@@H]3OCc3ccccc3)c2n1 |
| InChI | InChI=1S/C32H31ClN4O4/c33-29-25-16-17-37(30(25)36-32(34)35-29)31-28(40-20-24-14-8-3-9-15-24)27(39-19-23-12-6-2-7-13-23)26(41-31)21-38-18-22-10-4-1-5-11-22/h1-17,26-28,31H,18-21H2,(H2,34,35,36)/t26-,27-,28+,31-/m1/s1 |
| InChIKey | IKCLUKFCFCKGBO-FATKCUQPSA-N |
| XLogP | 5.95 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.08 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |