C31H29ClN4O4 — CID 154710604
9-[(3S,4S,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-chloropurine (PubChem CID 154710604) has the molecular formula C31H29ClN4O4 and a molecular weight of 557.05 g/mol. Its IUPAC name is 9-[(3S,4S,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-chloropurine.
| Compound Name | 9-[(3S,4S,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-chloropurine |
|---|---|
| PubChem CID | 154710604 |
| Molecular Formula | C31H29ClN4O4 |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 9-[(3S,4S,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-chloropurine |
| SMILES | Clc1ncc2ncn(C3O[C@@H](COCc4ccccc4)[C@H](OCc4ccccc4)[C@@H]3OCc3ccccc3)c2n1 |
| InChI | InChI=1S/C31H29ClN4O4/c32-31-33-16-25-29(35-31)36(21-34-25)30-28(39-19-24-14-8-3-9-15-24)27(38-18-23-12-6-2-7-13-23)26(40-30)20-37-17-22-10-4-1-5-11-22/h1-16,21,26-28,30H,17-20H2/t26-,27-,28-,30?/m0/s1 |
| InChIKey | ZHKINCBSRWQGEJ-JNVBTDMXSA-N |
| XLogP | 5.76 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |