C31H28FN7O4 — CID 54489761
6-azido-9-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-fluoropurine (PubChem CID 54489761) has the molecular formula C31H28FN7O4 and a molecular weight of 581.61 g/mol. Its IUPAC name is 6-azido-9-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-fluoropurine.
| Compound Name | 6-azido-9-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-fluoropurine |
|---|---|
| PubChem CID | 54489761 |
| Molecular Formula | C31H28FN7O4 |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 6-azido-9-[(2R,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-2-fluoropurine |
| SMILES | [N-]=[N+]=Nc1nc(F)nc2c1ncn2[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H28FN7O4/c32-31-35-28(37-38-33)25-29(36-31)39(20-34-25)30-27(42-18-23-14-8-3-9-15-23)26(41-17-22-12-6-2-7-13-22)24(43-30)19-40-16-21-10-4-1-5-11-21/h1-15,20,24,26-27,30H,16-19H2/t24-,26-,27+,30-/m1/s1 |
| InChIKey | XUWMXIVIPBQSLJ-JVYBIVSJSA-N |
| XLogP | 6.19 |
| TPSA | 129.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|