C32H31N5O6 — CID 10579148
9-[(2R,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]purine (PubChem CID 10579148) has the molecular formula C32H31N5O6 and a molecular weight of 581.63 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]purine.
| Compound Name | 9-[(2R,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]purine |
|---|---|
| PubChem CID | 10579148 |
| Molecular Formula | C32H31N5O6 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 9-[(2R,3R,4R,5R,6R)-3-nitro-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]purine |
| SMILES | O=[N+]([O-])[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H]1n1cnc2cncnc21 |
| InChI | InChI=1S/C32H31N5O6/c38-37(39)28-30(42-19-25-14-8-3-9-15-25)29(41-18-24-12-6-2-7-13-24)27(20-40-17-23-10-4-1-5-11-23)43-32(28)36-22-35-26-16-33-21-34-31(26)36/h1-16,21-22,27-30,32H,17-20H2/t27-,28-,29+,30-,32-/m1/s1 |
| InChIKey | SRVYBEIFMGGRFG-LTGXLJKXSA-N |
| XLogP | 4.76 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|