C26H25FN4O3S — CID 175724383
(3S,4R,5R)-3-fluoro-2-(4-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)cyclopentan-1-one (PubChem CID 175724383) has the molecular formula C26H25FN4O3S and a molecular weight of 492.58 g/mol. Its IUPAC name is (3S,4R,5R)-3-fluoro-2-(4-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)cyclopentan-1-one.
| Compound Name | (3S,4R,5R)-3-fluoro-2-(4-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 175724383 |
| Molecular Formula | C26H25FN4O3S |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (3S,4R,5R)-3-fluoro-2-(4-methylsulfanylimidazo[2,1-f][1,2,4]triazin-7-yl)-4-phenylmethoxy-5-(phenylmethoxymethyl)cyclopentan-1-one |
| SMILES | CSc1ncnn2c(C3C(=O)[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H]3F)cnc12 |
| InChI | InChI=1S/C26H25FN4O3S/c1-35-26-25-28-12-20(31(25)30-16-29-26)21-22(27)24(34-14-18-10-6-3-7-11-18)19(23(21)32)15-33-13-17-8-4-2-5-9-17/h2-12,16,19,21-22,24H,13-15H2,1H3/t19-,21?,22-,24+/m0/s1 |
| InChIKey | YOVRINFUFSANFS-FIQIYMRGSA-N |
| XLogP | 4.27 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |