C18H19FN4O2S — CID 155222822
7-[(2S,3S,5S)-3-fluoro-5-(phenylmethoxymethyl)oxolan-2-yl]-4-methylsulfanylimidazo[2,1-f][1,2,4]triazine (PubChem CID 155222822) has the molecular formula C18H19FN4O2S and a molecular weight of 374.44 g/mol. Its IUPAC name is 7-[(2S,3S,5S)-3-fluoro-5-(phenylmethoxymethyl)oxolan-2-yl]-4-methylsulfanylimidazo[2,1-f][1,2,4]triazine.
| Compound Name | 7-[(2S,3S,5S)-3-fluoro-5-(phenylmethoxymethyl)oxolan-2-yl]-4-methylsulfanylimidazo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 155222822 |
| Molecular Formula | C18H19FN4O2S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 7-[(2S,3S,5S)-3-fluoro-5-(phenylmethoxymethyl)oxolan-2-yl]-4-methylsulfanylimidazo[2,1-f][1,2,4]triazine |
| SMILES | CSc1ncnn2c([C@@H]3O[C@H](COCc4ccccc4)C[C@@H]3F)cnc12 |
| InChI | InChI=1S/C18H19FN4O2S/c1-26-18-17-20-8-15(23(17)22-11-21-18)16-14(19)7-13(25-16)10-24-9-12-5-3-2-4-6-12/h2-6,8,11,13-14,16H,7,9-10H2,1H3/t13-,14-,16+/m0/s1 |
| InChIKey | CRGISGTUJJIRKX-OFQRWUPVSA-N |
| XLogP | 3.23 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |