C22H39NO5 — CID 70928813
(3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyl-2-(1H-pyrrol-2-yl)oxolan-2-ol (PubChem CID 70928813) has the molecular formula C22H39NO5 and a molecular weight of 397.56 g/mol. Its IUPAC name is (3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyl-2-(1H-pyrrol-2-yl)oxolan-2-ol.
| Compound Name | (3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyl-2-(1H-pyrrol-2-yl)oxolan-2-ol |
|---|---|
| PubChem CID | 70928813 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | (3R,4R,5R)-3,4-dibutoxy-5-(butoxymethyl)-3-methyl-2-(1H-pyrrol-2-yl)oxolan-2-ol |
| SMILES | CCCCOC[C@H]1OC(O)(c2ccc[nH]2)[C@](C)(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C22H39NO5/c1-5-8-14-25-17-18-20(26-15-9-6-2)21(4,27-16-10-7-3)22(24,28-18)19-12-11-13-23-19/h11-13,18,20,23-24H,5-10,14-17H2,1-4H3/t18-,20-,21-,22?/m1/s1 |
| InChIKey | LFDFIDUKUPFAMC-JQMRATEZSA-N |
| XLogP | 4.14 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|