C14H21FN2O6 — CID 130425924
1-[(2R,3R,5R)-5-(butoxymethyl)-3-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 130425924) has the molecular formula C14H21FN2O6 and a molecular weight of 332.33 g/mol. Its IUPAC name is 1-[(2R,3R,5R)-5-(butoxymethyl)-3-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5R)-5-(butoxymethyl)-3-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 130425924 |
| Molecular Formula | C14H21FN2O6 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[(2R,3R,5R)-5-(butoxymethyl)-3-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCOC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@](O)(CF)C1O |
| InChI | InChI=1S/C14H21FN2O6/c1-2-3-6-22-7-9-11(19)14(21,8-15)12(23-9)17-5-4-10(18)16-13(17)20/h4-5,9,11-12,19,21H,2-3,6-8H2,1H3,(H,16,18,20)/t9-,11?,12-,14-/m1/s1 |
| InChIKey | BKRXQAAHWCFOGL-VXYFJCLZSA-N |
| XLogP | -0.69 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|