C16H24N2O6 — CID 71241389
methyl (2S,3R,5S)-2-(butoxymethyl)-5-(2,4-dioxopyrimidin-1-yl)-3-methyloxolane-3-carboxylate (PubChem CID 71241389) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl (2S,3R,5S)-2-(butoxymethyl)-5-(2,4-dioxopyrimidin-1-yl)-3-methyloxolane-3-carboxylate.
| Compound Name | methyl (2S,3R,5S)-2-(butoxymethyl)-5-(2,4-dioxopyrimidin-1-yl)-3-methyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 71241389 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | methyl (2S,3R,5S)-2-(butoxymethyl)-5-(2,4-dioxopyrimidin-1-yl)-3-methyloxolane-3-carboxylate |
| SMILES | CCCCOC[C@H]1O[C@H](n2ccc(=O)[nH]c2=O)C[C@@]1(C)C(=O)OC |
| InChI | InChI=1S/C16H24N2O6/c1-4-5-8-23-10-11-16(2,14(20)22-3)9-13(24-11)18-7-6-12(19)17-15(18)21/h6-7,11,13H,4-5,8-10H2,1-3H3,(H,17,19,21)/t11-,13+,16-/m1/s1 |
| InChIKey | LFVHWPNBAYCJJD-PVXIVEMSSA-N |
| XLogP | 0.82 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|