C14H16N2O7 — CID 90175875
2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-4-hydroxy-3-methoxyoxolan-2-yl]methoxy]acetaldehyde (PubChem CID 90175875) has the molecular formula C14H16N2O7 and a molecular weight of 324.29 g/mol. Its IUPAC name is 2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-4-hydroxy-3-methoxyoxolan-2-yl]methoxy]acetaldehyde.
| Compound Name | 2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-4-hydroxy-3-methoxyoxolan-2-yl]methoxy]acetaldehyde |
|---|---|
| PubChem CID | 90175875 |
| Molecular Formula | C14H16N2O7 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-ethynyl-4-hydroxy-3-methoxyoxolan-2-yl]methoxy]acetaldehyde |
| SMILES | C#C[C@@]1(O)[C@H](OC)[C@@H](COCC=O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C14H16N2O7/c1-3-14(20)11(21-2)9(8-22-7-6-17)23-12(14)16-5-4-10(18)15-13(16)19/h1,4-6,9,11-12,20H,7-8H2,2H3,(H,15,18,19)/t9-,11-,12-,14-/m1/s1 |
| InChIKey | MIBXPJTZCDUIIZ-XIDUGBJDSA-N |
| XLogP | -1.97 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|