C17H25FN2O6 — CID 172874316
[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl heptanoate (PubChem CID 172874316) has the molecular formula C17H25FN2O6 and a molecular weight of 372.39 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl heptanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl heptanoate |
|---|---|
| PubChem CID | 172874316 |
| Molecular Formula | C17H25FN2O6 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl heptanoate |
| SMILES | CCCCCCC(=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O |
| InChI | InChI=1S/C17H25FN2O6/c1-3-4-5-6-7-13(22)25-10-11-14(23)17(2,18)15(26-11)20-9-8-12(21)19-16(20)24/h8-9,11,14-15,23H,3-7,10H2,1-2H3,(H,19,21,24)/t11-,14-,15-,17-/m1/s1 |
| InChIKey | SUMBYSQHWGEDRS-BNGXUDDSSA-N |
| XLogP | 1.04 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|