C17H24FN3O8P+ — CID 154930099
[[(2S)-1-cyclobutyloxy-1-oxopropan-2-yl]amino]-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-oxophosphanium (PubChem CID 154930099) has the molecular formula C17H24FN3O8P+ and a molecular weight of 448.36 g/mol. Its IUPAC name is [[(2S)-1-cyclobutyloxy-1-oxopropan-2-yl]amino]-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-oxophosphanium.
| Compound Name | [[(2S)-1-cyclobutyloxy-1-oxopropan-2-yl]amino]-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 154930099 |
| Molecular Formula | C17H24FN3O8P+ |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [[(2S)-1-cyclobutyloxy-1-oxopropan-2-yl]amino]-[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy]-oxophosphanium |
| SMILES | C[C@H](N[P+](=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)C(=O)OC1CCC1 |
| InChI | InChI=1S/C17H23FN3O8P/c1-9(14(24)28-10-4-3-5-10)20-30(26)27-8-11-13(23)17(2,18)15(29-11)21-7-6-12(22)19-16(21)25/h6-7,9-11,13,15,23H,3-5,8H2,1-2H3,(H-,19,20,22,25,26)/p+1/t9-,11+,13+,15+,17+/m0/s1 |
| InChIKey | KQXYAOYBJAUUEB-KBAQJWDOSA-O |
| XLogP | 0.27 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|