C18H26BrClN4O9P+ — CID 126647919
[(2R,3R,4R,5R)-3-[(2S)-2-aminopropanoyl]oxy-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphanium (PubChem CID 126647919) has the molecular formula C18H26BrClN4O9P+ and a molecular weight of 588.76 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3-[(2S)-2-aminopropanoyl]oxy-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphanium.
| Compound Name | [(2R,3R,4R,5R)-3-[(2S)-2-aminopropanoyl]oxy-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphanium |
|---|---|
| PubChem CID | 126647919 |
| Molecular Formula | C18H26BrClN4O9P+ |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 587.03 |
| IUPAC Name | [(2R,3R,4R,5R)-3-[(2S)-2-aminopropanoyl]oxy-4-bromo-4-chloro-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxo-[[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]amino]phosphanium |
| SMILES | CC(C)OC(=O)[C@H](C)N[P+](=O)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](Cl)(Br)[C@@H]1OC(=O)[C@H](C)N |
| InChI | InChI=1S/C18H25BrClN4O9P/c1-8(2)31-15(27)10(4)23-34(29)30-7-11-13(33-14(26)9(3)21)18(19,20)16(32-11)24-6-5-12(25)22-17(24)28/h5-6,8-11,13,16H,7,21H2,1-4H3,(H-,22,23,25,28,29)/p+1/t9-,10-,11+,13+,16+,18-/m0/s1 |
| InChIKey | URTIGBIMNDORKR-PCBOIYSESA-O |
| XLogP | 0.63 |
| TPSA | 181.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|