C25H30BrFN3O9P — CID 67442642
CID 67442642 (PubChem CID 67442642) has the molecular formula C25H30BrFN3O9P and a molecular weight of 646.40 g/mol.
| Compound Name | CID 67442642 |
|---|---|
| PubChem CID | 67442642 |
| Molecular Formula | C25H30BrFN3O9P |
| Molecular Weight | 646.40 g/mol |
| Exact Mass | 645.09 |
| IUPAC Name | — |
| SMILES | C[C@H](/N=[P+](\[O-])Oc1ccc(Br)cc1OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](C)(F)[C@@H]1O)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C25H30BrFN3O9P/c1-14(22(33)37-16-6-4-3-5-7-16)29-40(35)39-17-9-8-15(26)12-18(17)36-13-19-21(32)25(2,27)23(38-19)30-11-10-20(31)28-24(30)34/h8-12,14,16,19,21,23,32H,3-7,13H2,1-2H3,(H,28,31,34)/t14-,19+,21+,23+,25+/m0/s1 |
| InChIKey | JKSMVJROHCQZBP-SZCJYMSISA-N |
| XLogP | 2.86 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|