C40H46O10SSi — CID 23516185
[2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]-4-phenylmethoxyoxolan-3-yl] acetate (PubChem CID 23516185) has the molecular formula C40H46O10SSi and a molecular weight of 746.95 g/mol. Its IUPAC name is [2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]-4-phenylmethoxyoxolan-3-yl] acetate.
| Compound Name | [2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]-4-phenylmethoxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 23516185 |
| Molecular Formula | C40H46O10SSi |
| Molecular Weight | 746.95 g/mol |
| Exact Mass | 746.26 |
| IUPAC Name | [2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(4-methylphenyl)sulfonyloxymethyl]-4-phenylmethoxyoxolan-3-yl] acetate |
| SMILES | CC(=O)OC1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(COS(=O)(=O)c2ccc(C)cc2)C(OCc2ccccc2)C1OC(C)=O |
| InChI | InChI=1S/C40H46O10SSi/c1-29-22-24-33(25-23-29)51(43,44)46-27-40(28-47-52(39(4,5)6,34-18-12-8-13-19-34)35-20-14-9-15-21-35)37(45-26-32-16-10-7-11-17-32)36(48-30(2)41)38(50-40)49-31(3)42/h7-25,36-38H,26-28H2,1-6H3 |
| InChIKey | SEIHLFKFMDMLQX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.95 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|