C12H19NO6 — CID 71605872
dimethyl (3aS,6S,7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5,6-dicarboxylate (PubChem CID 71605872) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is dimethyl (3aS,6S,7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5,6-dicarboxylate.
| Compound Name | dimethyl (3aS,6S,7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 71605872 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | dimethyl (3aS,6S,7aR)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H]2OC(C)(C)O[C@H]2CN1C(=O)OC |
| InChI | InChI=1S/C12H19NO6/c1-12(2)18-8-5-7(10(14)16-3)13(11(15)17-4)6-9(8)19-12/h7-9H,5-6H2,1-4H3/t7-,8+,9-/m0/s1 |
| InChIKey | DAYAWDVOKRKPLU-YIZRAAEISA-N |
| XLogP | 0.52 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |