C10H17NO5 — CID 139799351
dimethyl (2S,5R)-5-methoxypiperidine-1,2-dicarboxylate (PubChem CID 139799351) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is dimethyl (2S,5R)-5-methoxypiperidine-1,2-dicarboxylate.
| Compound Name | dimethyl (2S,5R)-5-methoxypiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139799351 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | dimethyl (2S,5R)-5-methoxypiperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H](OC)CN1C(=O)OC |
| InChI | InChI=1S/C10H17NO5/c1-14-7-4-5-8(9(12)15-2)11(6-7)10(13)16-3/h7-8H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | GFYJJKMWQZVNBD-SFYZADRCSA-N |
| XLogP | 0.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |