C11H17NO6 — CID 139799358
dimethyl (2S,5R)-5-acetyloxypiperidine-1,2-dicarboxylate (PubChem CID 139799358) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is dimethyl (2S,5R)-5-acetyloxypiperidine-1,2-dicarboxylate.
| Compound Name | dimethyl (2S,5R)-5-acetyloxypiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139799358 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | dimethyl (2S,5R)-5-acetyloxypiperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H](OC(C)=O)CN1C(=O)OC |
| InChI | InChI=1S/C11H17NO6/c1-7(13)18-8-4-5-9(10(14)16-2)12(6-8)11(15)17-3/h8-9H,4-6H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | WBDZQLYXRUJEEJ-BDAKNGLRSA-N |
| XLogP | 0.32 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|