C13H19NO8 — CID 11130914
dimethyl (2S)-5,6-diacetyloxypiperidine-1,2-dicarboxylate (PubChem CID 11130914) has the molecular formula C13H19NO8 and a molecular weight of 317.29 g/mol. Its IUPAC name is dimethyl (2S)-5,6-diacetyloxypiperidine-1,2-dicarboxylate.
| Compound Name | dimethyl (2S)-5,6-diacetyloxypiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11130914 |
| Molecular Formula | C13H19NO8 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | dimethyl (2S)-5,6-diacetyloxypiperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CCC(OC(C)=O)C(OC(C)=O)N1C(=O)OC |
| InChI | InChI=1S/C13H19NO8/c1-7(15)21-10-6-5-9(12(17)19-3)14(13(18)20-4)11(10)22-8(2)16/h9-11H,5-6H2,1-4H3/t9-,10?,11?/m0/s1 |
| InChIKey | QNLNPSZAEJXAPU-WHXUTIOJSA-N |
| XLogP | 0.21 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|