C16H23NO10 — CID 101352051
methyl (6S)-2,3,4-triacetyloxy-6-(acetyloxymethyl)piperidine-1-carboxylate (PubChem CID 101352051) has the molecular formula C16H23NO10 and a molecular weight of 389.36 g/mol. Its IUPAC name is methyl (6S)-2,3,4-triacetyloxy-6-(acetyloxymethyl)piperidine-1-carboxylate.
| Compound Name | methyl (6S)-2,3,4-triacetyloxy-6-(acetyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 101352051 |
| Molecular Formula | C16H23NO10 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | methyl (6S)-2,3,4-triacetyloxy-6-(acetyloxymethyl)piperidine-1-carboxylate |
| SMILES | COC(=O)N1C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C[C@H]1COC(C)=O |
| InChI | InChI=1S/C16H23NO10/c1-8(18)24-7-12-6-13(25-9(2)19)14(26-10(3)20)15(27-11(4)21)17(12)16(22)23-5/h12-15H,6-7H2,1-5H3/t12-,13?,14?,15?/m0/s1 |
| InChIKey | RNAXPPIMFHQERJ-NAOUJUTFSA-N |
| XLogP | 0.14 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|