C7H13NO4 — CID 151000753
2-hydroxy-5-methoxypiperidine-1-carboxylic acid (PubChem CID 151000753) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-hydroxy-5-methoxypiperidine-1-carboxylic acid.
| Compound Name | 2-hydroxy-5-methoxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 151000753 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2-hydroxy-5-methoxypiperidine-1-carboxylic acid |
| SMILES | COC1CCC(O)N(C(=O)O)C1 |
| InChI | InChI=1S/C7H13NO4/c1-12-5-2-3-6(9)8(4-5)7(10)11/h5-6,9H,2-4H2,1H3,(H,10,11) |
| InChIKey | LUAWPYCXCHGWBZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |