C9H15NO3 — CID 130291367
(2S,5S)-1-acetyl-5-methoxypiperidine-2-carbaldehyde (PubChem CID 130291367) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (2S,5S)-1-acetyl-5-methoxypiperidine-2-carbaldehyde.
| Compound Name | (2S,5S)-1-acetyl-5-methoxypiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 130291367 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (2S,5S)-1-acetyl-5-methoxypiperidine-2-carbaldehyde |
| SMILES | CO[C@H]1CC[C@@H](C=O)N(C(C)=O)C1 |
| InChI | InChI=1S/C9H15NO3/c1-7(12)10-5-9(13-2)4-3-8(10)6-11/h6,8-9H,3-5H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | RWEBKKXPULHBAH-IUCAKERBSA-N |
| XLogP | 0.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|