C15H25NO5 — CID 142964787
4-[(1-formyl-5-methoxypiperidin-2-yl)methoxy]cyclohexane-1-carboxylic acid (PubChem CID 142964787) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-[(1-formyl-5-methoxypiperidin-2-yl)methoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(1-formyl-5-methoxypiperidin-2-yl)methoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 142964787 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-[(1-formyl-5-methoxypiperidin-2-yl)methoxy]cyclohexane-1-carboxylic acid |
| SMILES | COC1CCC(COC2CCC(C(=O)O)CC2)N(C=O)C1 |
| InChI | InChI=1S/C15H25NO5/c1-20-14-7-4-12(16(8-14)10-17)9-21-13-5-2-11(3-6-13)15(18)19/h10-14H,2-9H2,1H3,(H,18,19) |
| InChIKey | ZQZHJFLLCLLWSS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|