C10H15ClO3 — CID 114451265
4-[(E)-3-chloroprop-2-enoxy]cyclohexane-1-carboxylic acid (PubChem CID 114451265) has the molecular formula C10H15ClO3 and a molecular weight of 218.68 g/mol. Its IUPAC name is 4-[(E)-3-chloroprop-2-enoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(E)-3-chloroprop-2-enoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114451265 |
| Molecular Formula | C10H15ClO3 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4-[(E)-3-chloroprop-2-enoxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(OC/C=C/Cl)CC1 |
| InChI | InChI=1S/C10H15ClO3/c11-6-1-7-14-9-4-2-8(3-5-9)10(12)13/h1,6,8-9H,2-5,7H2,(H,12,13)/b6-1+ |
| InChIKey | IMMLPCASDWWMCX-LZCJLJQNSA-N |
| XLogP | 2.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |