C10H14Cl2O3 — CID 104928309
4-(2,3-dichloroprop-2-enoxy)cyclohexane-1-carboxylic acid (PubChem CID 104928309) has the molecular formula C10H14Cl2O3 and a molecular weight of 253.12 g/mol. Its IUPAC name is 4-(2,3-dichloroprop-2-enoxy)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(2,3-dichloroprop-2-enoxy)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 104928309 |
| Molecular Formula | C10H14Cl2O3 |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 4-(2,3-dichloroprop-2-enoxy)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(OCC(Cl)=CCl)CC1 |
| InChI | InChI=1S/C10H14Cl2O3/c11-5-8(12)6-15-9-3-1-7(2-4-9)10(13)14/h5,7,9H,1-4,6H2,(H,13,14) |
| InChIKey | ZOFXMHXSBIXJGF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |