C35H48O8 — CID 101366253
(1S,2R,4R,5R,9S,10R,13R,14R,15S,19S,20R)-13-ethyl-4,14-dihydroxy-2,4,10,14,19,20-hexamethyl-7,17-diphenyl-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one (PubChem CID 101366253) has the molecular formula C35H48O8 and a molecular weight of 596.76 g/mol. Its IUPAC name is (1S,2R,4R,5R,9S,10R,13R,14R,15S,19S,20R)-13-ethyl-4,14-dihydroxy-2,4,10,14,19,20-hexamethyl-7,17-diphenyl-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one.
| Compound Name | (1S,2R,4R,5R,9S,10R,13R,14R,15S,19S,20R)-13-ethyl-4,14-dihydroxy-2,4,10,14,19,20-hexamethyl-7,17-diphenyl-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one |
|---|---|
| PubChem CID | 101366253 |
| Molecular Formula | C35H48O8 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | (1S,2R,4R,5R,9S,10R,13R,14R,15S,19S,20R)-13-ethyl-4,14-dihydroxy-2,4,10,14,19,20-hexamethyl-7,17-diphenyl-6,8,12,16,18-pentaoxatricyclo[13.3.1.15,9]icosan-11-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@H]2OC(c3ccccc3)O[C@H]([C@@H]2C)[C@](C)(O)C[C@@H](C)[C@@H]2OC(c3ccccc3)O[C@@H]([C@H]2C)[C@]1(C)O |
| InChI | InChI=1S/C35H48O8/c1-8-26-35(7,38)30-21(3)27(40-32(43-30)24-15-11-9-12-16-24)20(2)19-34(6,37)29-22(4)28(23(5)31(36)39-26)41-33(42-29)25-17-13-10-14-18-25/h9-18,20-23,26-30,32-33,37-38H,8,19H2,1-7H3/t20-,21+,22-,23-,26-,27+,28+,29-,30+,32?,33?,34-,35-/m1/s1 |
| InChIKey | MZLDSFPGDPUDGB-OMKOJESKSA-N |
| XLogP | 5.72 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |