C28H39NO8 — CID 122174307
(1S,2R,5R,6R,7E,10R,12S,13R,17S)-5-ethyl-12-hydroxy-2,6,8,10,12,17-hexamethyl-15-(3-nitrophenyl)-4,14,16-trioxabicyclo[11.3.1]heptadec-7-ene-3,9-dione (PubChem CID 122174307) has the molecular formula C28H39NO8 and a molecular weight of 517.62 g/mol. Its IUPAC name is (1S,2R,5R,6R,7E,10R,12S,13R,17S)-5-ethyl-12-hydroxy-2,6,8,10,12,17-hexamethyl-15-(3-nitrophenyl)-4,14,16-trioxabicyclo[11.3.1]heptadec-7-ene-3,9-dione.
| Compound Name | (1S,2R,5R,6R,7E,10R,12S,13R,17S)-5-ethyl-12-hydroxy-2,6,8,10,12,17-hexamethyl-15-(3-nitrophenyl)-4,14,16-trioxabicyclo[11.3.1]heptadec-7-ene-3,9-dione |
|---|---|
| PubChem CID | 122174307 |
| Molecular Formula | C28H39NO8 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | (1S,2R,5R,6R,7E,10R,12S,13R,17S)-5-ethyl-12-hydroxy-2,6,8,10,12,17-hexamethyl-15-(3-nitrophenyl)-4,14,16-trioxabicyclo[11.3.1]heptadec-7-ene-3,9-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@H]2OC(c3cccc([N+](=O)[O-])c3)O[C@H]([C@H]2C)[C@@](C)(O)C[C@@H](C)C(=O)/C(C)=C/[C@H]1C |
| InChI | InChI=1S/C28H39NO8/c1-8-22-15(2)12-16(3)23(30)17(4)14-28(7,32)25-18(5)24(19(6)26(31)35-22)36-27(37-25)20-10-9-11-21(13-20)29(33)34/h9-13,15,17-19,22,24-25,27,32H,8,14H2,1-7H3/b16-12+/t15-,17-,18+,19-,22-,24+,25-,27?,28+/m1/s1 |
| InChIKey | JHBJHQHUBOLLCZ-XISOJYKVSA-N |
| XLogP | 4.91 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|